C7H11N5O2 — CID 102806911
N-(1,3-dimethylpyrazol-4-yl)-2-hydrazinyl-2-oxoacetamide (PubChem CID 102806911) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 102806911 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-2-hydrazinyl-2-oxoacetamide |
| SMILES | Cc1nn(C)cc1NC(=O)C(=O)NN |
| InChI | InChI=1S/C7H11N5O2/c1-4-5(3-12(2)11-4)9-6(13)7(14)10-8/h3H,8H2,1-2H3,(H,9,13)(H,10,14) |
| InChIKey | SWLNNSUESSEJNG-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|