About 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide
1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide (PubChem CID 102804722) has the molecular formula C12H20N4O
and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide |
| PubChem CID | 102804722 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide |
| SMILES | Cc1nn(C)cc1NC(=O)C1(CN)CC(C)C1 |
| InChI | InChI=1S/C12H20N4O/c1-8-4-12(5-8,7-13)11(17)14-10-6-16(3)15-9(10)2/h6,8H,4-5,7,13H2,1-3H3,(H,14,17) |
| InChIKey | JHKXWAOIMRXPRE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide?
The IUPAC name of 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide (CID 102804722) is 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide.
What is the SMILES notation for 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide?
The canonical SMILES for 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide is Cc1nn(C)cc1NC(=O)C1(CN)CC(C)C1.
What is the InChIKey of 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide?
The InChIKey is JHKXWAOIMRXPRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O/c1-8-4-12(5-8,7-13)11(17)14-10-6-16(3)15-9(10)2/h6,8H,4-5,7,13H2,1-3H3,(H,14,17).
What are the key properties of 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide?
1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide has a molecular weight of 236.32 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)-3-methylcyclobutane-1-carboxamide is sourced from PubChem (CID 102804722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).