C13H16N4O — CID 103796977
4-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)benzamide (PubChem CID 103796977) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)benzamide.
| Compound Name | 4-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 103796977 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-(aminomethyl)-N-(1,3-dimethylpyrazol-4-yl)benzamide |
| SMILES | Cc1nn(C)cc1NC(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C13H16N4O/c1-9-12(8-17(2)16-9)15-13(18)11-5-3-10(7-14)4-6-11/h3-6,8H,7,14H2,1-2H3,(H,15,18) |
| InChIKey | JXMUWHFYUCUBFC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |