C14H17N5O2 — CID 102805519
4-amino-N-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]benzamide (PubChem CID 102805519) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-amino-N-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-amino-N-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 102805519 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-amino-N-[2-[(1,3-dimethylpyrazol-4-yl)amino]-2-oxoethyl]benzamide |
| SMILES | Cc1nn(C)cc1NC(=O)CNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H17N5O2/c1-9-12(8-19(2)18-9)17-13(20)7-16-14(21)10-3-5-11(15)6-4-10/h3-6,8H,7,15H2,1-2H3,(H,16,21)(H,17,20) |
| InChIKey | LVGHLIXIZJTGKW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|