C14H24N4O2 — CID 71846896
N-(4,4-dimethylpentyl)-N'-(1,3-dimethylpyrazol-4-yl)oxamide (PubChem CID 71846896) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-N'-(1,3-dimethylpyrazol-4-yl)oxamide.
| Compound Name | N-(4,4-dimethylpentyl)-N'-(1,3-dimethylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 71846896 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-(4,4-dimethylpentyl)-N'-(1,3-dimethylpyrazol-4-yl)oxamide |
| SMILES | Cc1nn(C)cc1NC(=O)C(=O)NCCCC(C)(C)C |
| InChI | InChI=1S/C14H24N4O2/c1-10-11(9-18(5)17-10)16-13(20)12(19)15-8-6-7-14(2,3)4/h9H,6-8H2,1-5H3,(H,15,19)(H,16,20) |
| InChIKey | QEZOFQGFTFYVCL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|