C9H12N6O3S — CID 61132038
1-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyrazole-4-carboxamide (PubChem CID 61132038) has the molecular formula C9H12N6O3S and a molecular weight of 284.30 g/mol. Its IUPAC name is 1-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 61132038 |
| Molecular Formula | C9H12N6O3S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-methyl-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2nn(C)cc2S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C9H12N6O3S/c1-14-4-6(3-11-14)9(16)12-8-7(19(10,17)18)5-15(2)13-8/h3-5H,1-2H3,(H2,10,17,18)(H,12,13,16) |
| InChIKey | PSBDVDSQDDKKKZ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |