C11H13N5O4S — CID 105064336
3-methoxy-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyridine-4-carboxamide (PubChem CID 105064336) has the molecular formula C11H13N5O4S and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-methoxy-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyridine-4-carboxamide.
| Compound Name | 3-methoxy-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105064336 |
| Molecular Formula | C11H13N5O4S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-methoxy-N-(1-methyl-4-sulfamoylpyrazol-3-yl)pyridine-4-carboxamide |
| SMILES | COc1cnccc1C(=O)Nc1nn(C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H13N5O4S/c1-16-6-9(21(12,18)19)10(15-16)14-11(17)7-3-4-13-5-8(7)20-2/h3-6H,1-2H3,(H2,12,18,19)(H,14,15,17) |
| InChIKey | STINDOKNNDYKMW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |