C9H9ClN4O4S — CID 106689384
2-chloro-N-(1-methyl-4-sulfamoylpyrazol-3-yl)furan-3-carboxamide (PubChem CID 106689384) has the molecular formula C9H9ClN4O4S and a molecular weight of 304.72 g/mol. Its IUPAC name is 2-chloro-N-(1-methyl-4-sulfamoylpyrazol-3-yl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(1-methyl-4-sulfamoylpyrazol-3-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106689384 |
| Molecular Formula | C9H9ClN4O4S |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 2-chloro-N-(1-methyl-4-sulfamoylpyrazol-3-yl)furan-3-carboxamide |
| SMILES | Cn1cc(S(N)(=O)=O)c(NC(=O)c2ccoc2Cl)n1 |
| InChI | InChI=1S/C9H9ClN4O4S/c1-14-4-6(19(11,16)17)8(13-14)12-9(15)5-2-3-18-7(5)10/h2-4H,1H3,(H2,11,16,17)(H,12,13,15) |
| InChIKey | WMIANJRMROGACO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |