C8H15N5O4S2 — CID 61131751
1-methyl-3-(pyrrolidin-1-ylsulfonylamino)pyrazole-4-sulfonamide (PubChem CID 61131751) has the molecular formula C8H15N5O4S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-methyl-3-(pyrrolidin-1-ylsulfonylamino)pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-3-(pyrrolidin-1-ylsulfonylamino)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61131751 |
| Molecular Formula | C8H15N5O4S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1-methyl-3-(pyrrolidin-1-ylsulfonylamino)pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(N)(=O)=O)c(NS(=O)(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C8H15N5O4S2/c1-12-6-7(18(9,14)15)8(10-12)11-19(16,17)13-4-2-3-5-13/h6H,2-5H2,1H3,(H,10,11)(H2,9,14,15) |
| InChIKey | CGXDFKONDPXOBX-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |