C10H16N4O4S — CID 65159312
N-(1-methyl-4-sulfamoylpyrazol-3-yl)-2-(oxolan-2-yl)acetamide (PubChem CID 65159312) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(1-methyl-4-sulfamoylpyrazol-3-yl)-2-(oxolan-2-yl)acetamide.
| Compound Name | N-(1-methyl-4-sulfamoylpyrazol-3-yl)-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 65159312 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(1-methyl-4-sulfamoylpyrazol-3-yl)-2-(oxolan-2-yl)acetamide |
| SMILES | Cn1cc(S(N)(=O)=O)c(NC(=O)CC2CCCO2)n1 |
| InChI | InChI=1S/C10H16N4O4S/c1-14-6-8(19(11,16)17)10(13-14)12-9(15)5-7-3-2-4-18-7/h6-7H,2-5H2,1H3,(H2,11,16,17)(H,12,13,15) |
| InChIKey | LELBUWCSUQZXII-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |