C12H14Cl2N2O4S — CID 65155701
N-(2,6-dichloro-4-sulfamoylphenyl)-2-(oxolan-2-yl)acetamide (PubChem CID 65155701) has the molecular formula C12H14Cl2N2O4S and a molecular weight of 353.23 g/mol. Its IUPAC name is N-(2,6-dichloro-4-sulfamoylphenyl)-2-(oxolan-2-yl)acetamide.
| Compound Name | N-(2,6-dichloro-4-sulfamoylphenyl)-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 65155701 |
| Molecular Formula | C12H14Cl2N2O4S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-(2,6-dichloro-4-sulfamoylphenyl)-2-(oxolan-2-yl)acetamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(NC(=O)CC2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O4S/c13-9-5-8(21(15,18)19)6-10(14)12(9)16-11(17)4-7-2-1-3-20-7/h5-7H,1-4H2,(H,16,17)(H2,15,18,19) |
| InChIKey | GXBYWGAXQAMVMS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |