C9H7Cl2F3N2O3S — CID 43246826
N-(2,6-dichloro-4-sulfamoylphenyl)-3,3,3-trifluoropropanamide (PubChem CID 43246826) has the molecular formula C9H7Cl2F3N2O3S and a molecular weight of 351.13 g/mol. Its IUPAC name is N-(2,6-dichloro-4-sulfamoylphenyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(2,6-dichloro-4-sulfamoylphenyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 43246826 |
| Molecular Formula | C9H7Cl2F3N2O3S |
| Molecular Weight | 351.13 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | N-(2,6-dichloro-4-sulfamoylphenyl)-3,3,3-trifluoropropanamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(NC(=O)CC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2F3N2O3S/c10-5-1-4(20(15,18)19)2-6(11)8(5)16-7(17)3-9(12,13)14/h1-2H,3H2,(H,16,17)(H2,15,18,19) |
| InChIKey | NPAFTYRPPLWQPN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |