C13H18Cl2N2O3S — CID 43246574
N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)-3,3-dimethylbutanamide (PubChem CID 43246574) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)-3,3-dimethylbutanamide.
| Compound Name | N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 43246574 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)-3,3-dimethylbutanamide |
| SMILES | Cc1c(S(N)(=O)=O)cc(Cl)c(NC(=O)CC(C)(C)C)c1Cl |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-7-9(21(16,19)20)5-8(14)12(11(7)15)17-10(18)6-13(2,3)4/h5H,6H2,1-4H3,(H,17,18)(H2,16,19,20) |
| InChIKey | CSRZNCMLJRLLQQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |