C8H10Cl2N4O5S2 — CID 10833411
2-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)acetamide (PubChem CID 10833411) has the molecular formula C8H10Cl2N4O5S2 and a molecular weight of 377.23 g/mol. Its IUPAC name is 2-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)acetamide.
| Compound Name | 2-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 10833411 |
| Molecular Formula | C8H10Cl2N4O5S2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 2-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)acetamide |
| SMILES | NCC(=O)Nc1c(S(N)(=O)=O)cc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C8H10Cl2N4O5S2/c9-6-3(20(12,16)17)1-4(21(13,18)19)8(7(6)10)14-5(15)2-11/h1H,2,11H2,(H,14,15)(H2,12,16,17)(H2,13,18,19) |
| InChIKey | IVDRQODMKDJZCG-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 175.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |