C9H12Cl2N4O5S2 — CID 10834283
3-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)propanamide (PubChem CID 10834283) has the molecular formula C9H12Cl2N4O5S2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 3-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)propanamide.
| Compound Name | 3-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 10834283 |
| Molecular Formula | C9H12Cl2N4O5S2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 3-amino-N-(2,3-dichloro-4,6-disulfamoylphenyl)propanamide |
| SMILES | NCCC(=O)Nc1c(S(N)(=O)=O)cc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C9H12Cl2N4O5S2/c10-7-4(21(13,17)18)3-5(22(14,19)20)9(8(7)11)15-6(16)1-2-12/h3H,1-2,12H2,(H,15,16)(H2,13,17,18)(H2,14,19,20) |
| InChIKey | VBVRQMRYTQKCHJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 175.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |