C11H11Cl2N3O4 — CID 82830278
4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3,5-dichlorobenzoic acid (PubChem CID 82830278) has the molecular formula C11H11Cl2N3O4 and a molecular weight of 320.13 g/mol. Its IUPAC name is 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3,5-dichlorobenzoic acid.
| Compound Name | 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 82830278 |
| Molecular Formula | C11H11Cl2N3O4 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3,5-dichlorobenzoic acid |
| SMILES | NCC(=O)NCC(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O4/c12-6-1-5(11(19)20)2-7(13)10(6)16-9(18)4-15-8(17)3-14/h1-2H,3-4,14H2,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | CJJWXYBVKLNMOO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |