C6H7Cl2N3O4S2 — CID 115580042
3,5-dichloro-4-(sulfamoylamino)benzenesulfonamide (PubChem CID 115580042) has the molecular formula C6H7Cl2N3O4S2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 3,5-dichloro-4-(sulfamoylamino)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(sulfamoylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 115580042 |
| Molecular Formula | C6H7Cl2N3O4S2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 3,5-dichloro-4-(sulfamoylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)Nc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C6H7Cl2N3O4S2/c7-4-1-3(16(9,12)13)2-5(8)6(4)11-17(10,14)15/h1-2,11H,(H2,9,12,13)(H2,10,14,15) |
| InChIKey | ZIIRIQDZRJOGPW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |