C6H6Cl2N2O2S — CID 16648290
1,3-dichloro-2-(sulfamoylamino)benzene (PubChem CID 16648290) has the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.10 g/mol. Its IUPAC name is 1,3-dichloro-2-(sulfamoylamino)benzene.
| Compound Name | 1,3-dichloro-2-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 16648290 |
| Molecular Formula | C6H6Cl2N2O2S |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 1,3-dichloro-2-(sulfamoylamino)benzene |
| SMILES | NS(=O)(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C6H6Cl2N2O2S/c7-4-2-1-3-5(8)6(4)10-13(9,11)12/h1-3,10H,(H2,9,11,12) |
| InChIKey | OBAOEHJABRNPDR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |