C12H11Cl2N3O2S — CID 115992809
2-amino-3-(2,6-dichloroanilino)benzenesulfonamide (PubChem CID 115992809) has the molecular formula C12H11Cl2N3O2S and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-amino-3-(2,6-dichloroanilino)benzenesulfonamide.
| Compound Name | 2-amino-3-(2,6-dichloroanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 115992809 |
| Molecular Formula | C12H11Cl2N3O2S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2-amino-3-(2,6-dichloroanilino)benzenesulfonamide |
| SMILES | Nc1c(Nc2c(Cl)cccc2Cl)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H11Cl2N3O2S/c13-7-3-1-4-8(14)12(7)17-9-5-2-6-10(11(9)15)20(16,18)19/h1-6,17H,15H2,(H2,16,18,19) |
| InChIKey | GIAOZSAHVBNYKF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|