C10H16N4O3S — CID 112674844
2-(2-amino-3-sulfamoylanilino)-2-methylpropanamide (PubChem CID 112674844) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(2-amino-3-sulfamoylanilino)-2-methylpropanamide.
| Compound Name | 2-(2-amino-3-sulfamoylanilino)-2-methylpropanamide |
|---|---|
| PubChem CID | 112674844 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-(2-amino-3-sulfamoylanilino)-2-methylpropanamide |
| SMILES | CC(C)(Nc1cccc(S(N)(=O)=O)c1N)C(N)=O |
| InChI | InChI=1S/C10H16N4O3S/c1-10(2,9(12)15)14-6-4-3-5-7(8(6)11)18(13,16)17/h3-5,14H,11H2,1-2H3,(H2,12,15)(H2,13,16,17) |
| InChIKey | ITECDNGLAHNOSA-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|