C9H14N4O3S — CID 112674675
2-(2-amino-3-sulfamoylanilino)-N-methylacetamide (PubChem CID 112674675) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-(2-amino-3-sulfamoylanilino)-N-methylacetamide.
| Compound Name | 2-(2-amino-3-sulfamoylanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 112674675 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-(2-amino-3-sulfamoylanilino)-N-methylacetamide |
| SMILES | CNC(=O)CNc1cccc(S(N)(=O)=O)c1N |
| InChI | InChI=1S/C9H14N4O3S/c1-12-8(14)5-13-6-3-2-4-7(9(6)10)17(11,15)16/h2-4,13H,5,10H2,1H3,(H,12,14)(H2,11,15,16) |
| InChIKey | AYQGQGSEEJYZDN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|