C8H11Cl2N3O4S2 — CID 114812536
3,5-dichloro-4-(ethylsulfamoylamino)benzenesulfonamide (PubChem CID 114812536) has the molecular formula C8H11Cl2N3O4S2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 3,5-dichloro-4-(ethylsulfamoylamino)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(ethylsulfamoylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 114812536 |
| Molecular Formula | C8H11Cl2N3O4S2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 3,5-dichloro-4-(ethylsulfamoylamino)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)Nc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C8H11Cl2N3O4S2/c1-2-12-19(16,17)13-8-6(9)3-5(4-7(8)10)18(11,14)15/h3-4,12-13H,2H2,1H3,(H2,11,14,15) |
| InChIKey | OEHVPQBZFUMEAW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |