C10H15ClN2O5S2 — CID 66256597
3-chloro-4-(2-methoxyethylsulfonylamino)-5-methylbenzenesulfonamide (PubChem CID 66256597) has the molecular formula C10H15ClN2O5S2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 3-chloro-4-(2-methoxyethylsulfonylamino)-5-methylbenzenesulfonamide.
| Compound Name | 3-chloro-4-(2-methoxyethylsulfonylamino)-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66256597 |
| Molecular Formula | C10H15ClN2O5S2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-chloro-4-(2-methoxyethylsulfonylamino)-5-methylbenzenesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1c(C)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C10H15ClN2O5S2/c1-7-5-8(20(12,16)17)6-9(11)10(7)13-19(14,15)4-3-18-2/h5-6,13H,3-4H2,1-2H3,(H2,12,16,17) |
| InChIKey | DOBRPERIMLSVEA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |