C13H22N2O4S2 — CID 43246862
4-(butylsulfonylamino)-3-ethyl-5-methylbenzenesulfonamide (PubChem CID 43246862) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-(butylsulfonylamino)-3-ethyl-5-methylbenzenesulfonamide.
| Compound Name | 4-(butylsulfonylamino)-3-ethyl-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43246862 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-(butylsulfonylamino)-3-ethyl-5-methylbenzenesulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1c(C)cc(S(N)(=O)=O)cc1CC |
| InChI | InChI=1S/C13H22N2O4S2/c1-4-6-7-20(16,17)15-13-10(3)8-12(21(14,18)19)9-11(13)5-2/h8-9,15H,4-7H2,1-3H3,(H2,14,18,19) |
| InChIKey | VAKDXKKWLHKTJQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |