C12H20N2O5S2 — CID 43246882
3-(butylsulfonylamino)-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 43246882) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-(butylsulfonylamino)-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | 3-(butylsulfonylamino)-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43246882 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-(butylsulfonylamino)-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1cc(C)cc(S(N)(=O)=O)c1OC |
| InChI | InChI=1S/C12H20N2O5S2/c1-4-5-6-20(15,16)14-10-7-9(2)8-11(12(10)19-3)21(13,17)18/h7-8,14H,4-6H2,1-3H3,(H2,13,17,18) |
| InChIKey | RNYLAMJMQLLGMO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |