C8H13N3O5S2 — CID 115580034
2-methoxy-5-methyl-3-(sulfamoylamino)benzenesulfonamide (PubChem CID 115580034) has the molecular formula C8H13N3O5S2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-methoxy-5-methyl-3-(sulfamoylamino)benzenesulfonamide.
| Compound Name | 2-methoxy-5-methyl-3-(sulfamoylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 115580034 |
| Molecular Formula | C8H13N3O5S2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-methoxy-5-methyl-3-(sulfamoylamino)benzenesulfonamide |
| SMILES | COc1c(NS(N)(=O)=O)cc(C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H13N3O5S2/c1-5-3-6(11-18(10,14)15)8(16-2)7(4-5)17(9,12)13/h3-4,11H,1-2H3,(H2,9,12,13)(H2,10,14,15) |
| InChIKey | QIMVHEPPGHRJOF-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |