C7H7F2NO2S — CID 119018924
2,3-difluoro-5-methylbenzenesulfonamide (PubChem CID 119018924) has the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. Its IUPAC name is 2,3-difluoro-5-methylbenzenesulfonamide.
| Compound Name | 2,3-difluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119018924 |
| Molecular Formula | C7H7F2NO2S |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 2,3-difluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)c(F)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H7F2NO2S/c1-4-2-5(8)7(9)6(3-4)13(10,11)12/h2-3H,1H3,(H2,10,11,12) |
| InChIKey | PHXLKNFUIFXNEW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |