C9H12F2N2O2S — CID 105120231
5-(ethylaminomethyl)-2,3-difluorobenzenesulfonamide (PubChem CID 105120231) has the molecular formula C9H12F2N2O2S and a molecular weight of 250.27 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-2,3-difluorobenzenesulfonamide.
| Compound Name | 5-(ethylaminomethyl)-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 105120231 |
| Molecular Formula | C9H12F2N2O2S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-(ethylaminomethyl)-2,3-difluorobenzenesulfonamide |
| SMILES | CCNCc1cc(F)c(F)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H12F2N2O2S/c1-2-13-5-6-3-7(10)9(11)8(4-6)16(12,14)15/h3-4,13H,2,5H2,1H3,(H2,12,14,15) |
| InChIKey | ZADAPZNPUJOPOA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |