C8H10F2N2O3S — CID 133098978
6-(difluoromethyl)-3-methoxy-2-methylpyridine-4-sulfonamide (PubChem CID 133098978) has the molecular formula C8H10F2N2O3S and a molecular weight of 252.24 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-methoxy-2-methylpyridine-4-sulfonamide.
| Compound Name | 6-(difluoromethyl)-3-methoxy-2-methylpyridine-4-sulfonamide |
|---|---|
| PubChem CID | 133098978 |
| Molecular Formula | C8H10F2N2O3S |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 6-(difluoromethyl)-3-methoxy-2-methylpyridine-4-sulfonamide |
| SMILES | COc1c(S(N)(=O)=O)cc(C(F)F)nc1C |
| InChI | InChI=1S/C8H10F2N2O3S/c1-4-7(15-2)6(16(11,13)14)3-5(12-4)8(9)10/h3,8H,1-2H3,(H2,11,13,14) |
| InChIKey | SYVSENKYCONKFK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |