C7H9F2N3O3S — CID 118817873
4-amino-6-(difluoromethyl)-2-methoxypyridine-3-sulfonamide (PubChem CID 118817873) has the molecular formula C7H9F2N3O3S and a molecular weight of 253.23 g/mol. Its IUPAC name is 4-amino-6-(difluoromethyl)-2-methoxypyridine-3-sulfonamide.
| Compound Name | 4-amino-6-(difluoromethyl)-2-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118817873 |
| Molecular Formula | C7H9F2N3O3S |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-amino-6-(difluoromethyl)-2-methoxypyridine-3-sulfonamide |
| SMILES | COc1nc(C(F)F)cc(N)c1S(N)(=O)=O |
| InChI | InChI=1S/C7H9F2N3O3S/c1-15-7-5(16(11,13)14)3(10)2-4(12-7)6(8)9/h2,6H,1H3,(H2,10,12)(H2,11,13,14) |
| InChIKey | CHCUTNDCAZUOKW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |