C7H8F3N3O4S — CID 118840565
4-amino-2-methoxy-6-(trifluoromethoxy)pyridine-3-sulfonamide (PubChem CID 118840565) has the molecular formula C7H8F3N3O4S and a molecular weight of 287.22 g/mol. Its IUPAC name is 4-amino-2-methoxy-6-(trifluoromethoxy)pyridine-3-sulfonamide.
| Compound Name | 4-amino-2-methoxy-6-(trifluoromethoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118840565 |
| Molecular Formula | C7H8F3N3O4S |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-amino-2-methoxy-6-(trifluoromethoxy)pyridine-3-sulfonamide |
| SMILES | COc1nc(OC(F)(F)F)cc(N)c1S(N)(=O)=O |
| InChI | InChI=1S/C7H8F3N3O4S/c1-16-6-5(18(12,14)15)3(11)2-4(13-6)17-7(8,9)10/h2H,1H3,(H2,11,13)(H2,12,14,15) |
| InChIKey | OGSGHOXLJBDPPG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |