C8H9F3N2O4S — CID 134679348
6-methoxy-2-methyl-5-(trifluoromethoxy)pyridine-3-sulfonamide (PubChem CID 134679348) has the molecular formula C8H9F3N2O4S and a molecular weight of 286.23 g/mol. Its IUPAC name is 6-methoxy-2-methyl-5-(trifluoromethoxy)pyridine-3-sulfonamide.
| Compound Name | 6-methoxy-2-methyl-5-(trifluoromethoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 134679348 |
| Molecular Formula | C8H9F3N2O4S |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 6-methoxy-2-methyl-5-(trifluoromethoxy)pyridine-3-sulfonamide |
| SMILES | COc1nc(C)c(S(N)(=O)=O)cc1OC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O4S/c1-4-6(18(12,14)15)3-5(7(13-4)16-2)17-8(9,10)11/h3H,1-2H3,(H2,12,14,15) |
| InChIKey | YNZHLTHEIWZPTP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |