C7H6F4N2O4S — CID 134676179
6-fluoro-5-methoxy-3-(trifluoromethoxy)pyridine-2-sulfonamide (PubChem CID 134676179) has the molecular formula C7H6F4N2O4S and a molecular weight of 290.19 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-3-(trifluoromethoxy)pyridine-2-sulfonamide.
| Compound Name | 6-fluoro-5-methoxy-3-(trifluoromethoxy)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134676179 |
| Molecular Formula | C7H6F4N2O4S |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 6-fluoro-5-methoxy-3-(trifluoromethoxy)pyridine-2-sulfonamide |
| SMILES | COc1cc(OC(F)(F)F)c(S(N)(=O)=O)nc1F |
| InChI | InChI=1S/C7H6F4N2O4S/c1-16-3-2-4(17-7(9,10)11)6(13-5(3)8)18(12,14)15/h2H,1H3,(H2,12,14,15) |
| InChIKey | CCPBLAJUHZUREX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|