C6H3F3IN3O5S — CID 134660949
6-iodo-3-nitro-5-(trifluoromethoxy)pyridine-2-sulfonamide (PubChem CID 134660949) has the molecular formula C6H3F3IN3O5S and a molecular weight of 413.07 g/mol. Its IUPAC name is 6-iodo-3-nitro-5-(trifluoromethoxy)pyridine-2-sulfonamide.
| Compound Name | 6-iodo-3-nitro-5-(trifluoromethoxy)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134660949 |
| Molecular Formula | C6H3F3IN3O5S |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 412.88 |
| IUPAC Name | 6-iodo-3-nitro-5-(trifluoromethoxy)pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc(I)c(OC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3F3IN3O5S/c7-6(8,9)18-3-1-2(13(14)15)5(12-4(3)10)19(11,16)17/h1H,(H2,11,16,17) |
| InChIKey | UOTUIFGJUFPVMP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|