C6H4F3N3O6S — CID 134666720
5-hydroxy-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide (PubChem CID 134666720) has the molecular formula C6H4F3N3O6S and a molecular weight of 303.17 g/mol. Its IUPAC name is 5-hydroxy-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide.
| Compound Name | 5-hydroxy-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134666720 |
| Molecular Formula | C6H4F3N3O6S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 5-hydroxy-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc([N+](=O)[O-])c(O)cc1OC(F)(F)F |
| InChI | InChI=1S/C6H4F3N3O6S/c7-6(8,9)18-3-1-2(13)4(12(14)15)11-5(3)19(10,16)17/h1,13H,(H2,10,16,17) |
| InChIKey | FEKBYAGYQZTIPR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 145.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|