C7H5F3N4O3S — CID 133094791
6-amino-5-cyano-3-(trifluoromethoxy)pyridine-2-sulfonamide (PubChem CID 133094791) has the molecular formula C7H5F3N4O3S and a molecular weight of 282.20 g/mol. Its IUPAC name is 6-amino-5-cyano-3-(trifluoromethoxy)pyridine-2-sulfonamide.
| Compound Name | 6-amino-5-cyano-3-(trifluoromethoxy)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 133094791 |
| Molecular Formula | C7H5F3N4O3S |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 6-amino-5-cyano-3-(trifluoromethoxy)pyridine-2-sulfonamide |
| SMILES | N#Cc1cc(OC(F)(F)F)c(S(N)(=O)=O)nc1N |
| InChI | InChI=1S/C7H5F3N4O3S/c8-7(9,10)17-4-1-3(2-11)5(12)14-6(4)18(13,15)16/h1H,(H2,12,14)(H2,13,15,16) |
| InChIKey | RLJXOZLHYUTNBT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 132.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |