C7H6F3N3O5S — CID 134669587
5-methyl-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide (PubChem CID 134669587) has the molecular formula C7H6F3N3O5S and a molecular weight of 301.20 g/mol. Its IUPAC name is 5-methyl-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide.
| Compound Name | 5-methyl-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134669587 |
| Molecular Formula | C7H6F3N3O5S |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 5-methyl-6-nitro-3-(trifluoromethoxy)pyridine-2-sulfonamide |
| SMILES | Cc1cc(OC(F)(F)F)c(S(N)(=O)=O)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6F3N3O5S/c1-3-2-4(18-7(8,9)10)6(19(11,16)17)12-5(3)13(14)15/h2H,1H3,(H2,11,16,17) |
| InChIKey | BEGQAQILWOBAKR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|