C7H3F6N3O5S — CID 134669805
6-nitro-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 134669805) has the molecular formula C7H3F6N3O5S and a molecular weight of 355.17 g/mol. Its IUPAC name is 6-nitro-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | 6-nitro-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 134669805 |
| Molecular Formula | C7H3F6N3O5S |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 6-nitro-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(OC(F)(F)F)c([N+](=O)[O-])nc1C(F)(F)F |
| InChI | InChI=1S/C7H3F6N3O5S/c8-6(9,10)4-3(22(14,19)20)1-2(21-7(11,12)13)5(15-4)16(17)18/h1H,(H2,14,19,20) |
| InChIKey | NHAGOFPOWCAABC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|