C7H6F3N3O6S — CID 134670336
3-methoxy-5-nitro-4-(trifluoromethoxy)pyridine-2-sulfonamide (PubChem CID 134670336) has the molecular formula C7H6F3N3O6S and a molecular weight of 317.20 g/mol. Its IUPAC name is 3-methoxy-5-nitro-4-(trifluoromethoxy)pyridine-2-sulfonamide.
| Compound Name | 3-methoxy-5-nitro-4-(trifluoromethoxy)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134670336 |
| Molecular Formula | C7H6F3N3O6S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 3-methoxy-5-nitro-4-(trifluoromethoxy)pyridine-2-sulfonamide |
| SMILES | COc1c(S(N)(=O)=O)ncc([N+](=O)[O-])c1OC(F)(F)F |
| InChI | InChI=1S/C7H6F3N3O6S/c1-18-5-4(19-7(8,9)10)3(13(14)15)2-12-6(5)20(11,16)17/h2H,1H3,(H2,11,16,17) |
| InChIKey | VFNZHINOOIOCEA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|