C7H7F2N3O5S — CID 133087554
3-(difluoromethyl)-4-methoxy-5-nitropyridine-2-sulfonamide (PubChem CID 133087554) has the molecular formula C7H7F2N3O5S and a molecular weight of 283.21 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-methoxy-5-nitropyridine-2-sulfonamide.
| Compound Name | 3-(difluoromethyl)-4-methoxy-5-nitropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 133087554 |
| Molecular Formula | C7H7F2N3O5S |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-(difluoromethyl)-4-methoxy-5-nitropyridine-2-sulfonamide |
| SMILES | COc1c([N+](=O)[O-])cnc(S(N)(=O)=O)c1C(F)F |
| InChI | InChI=1S/C7H7F2N3O5S/c1-17-5-3(12(13)14)2-11-7(18(10,15)16)4(5)6(8)9/h2,6H,1H3,(H2,10,15,16) |
| InChIKey | PXBNQSVOULOVRC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|