C6H5F2N3O5S — CID 118801115
4-(difluoromethyl)-5-hydroxy-3-nitropyridine-2-sulfonamide (PubChem CID 118801115) has the molecular formula C6H5F2N3O5S and a molecular weight of 269.18 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-hydroxy-3-nitropyridine-2-sulfonamide.
| Compound Name | 4-(difluoromethyl)-5-hydroxy-3-nitropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118801115 |
| Molecular Formula | C6H5F2N3O5S |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 4-(difluoromethyl)-5-hydroxy-3-nitropyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ncc(O)c(C(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5F2N3O5S/c7-5(8)3-2(12)1-10-6(17(9,15)16)4(3)11(13)14/h1,5,12H,(H2,9,15,16) |
| InChIKey | MBXNHBGWVHFJRE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|