C6H4ClF2N3O4S — CID 134685598
5-chloro-4-(difluoromethyl)-3-nitropyridine-2-sulfonamide (PubChem CID 134685598) has the molecular formula C6H4ClF2N3O4S and a molecular weight of 287.63 g/mol. Its IUPAC name is 5-chloro-4-(difluoromethyl)-3-nitropyridine-2-sulfonamide.
| Compound Name | 5-chloro-4-(difluoromethyl)-3-nitropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134685598 |
| Molecular Formula | C6H4ClF2N3O4S |
| Molecular Weight | 287.63 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 5-chloro-4-(difluoromethyl)-3-nitropyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ncc(Cl)c(C(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4ClF2N3O4S/c7-2-1-11-6(17(10,15)16)4(12(13)14)3(2)5(8)9/h1,5H,(H2,10,15,16) |
| InChIKey | ZTNJJRKRNDOAKV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.63 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|