C8H6F2N2O5 — CID 118806375
4-(difluoromethyl)-3-methoxy-5-nitropyridine-2-carboxylic acid (PubChem CID 118806375) has the molecular formula C8H6F2N2O5 and a molecular weight of 248.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-methoxy-5-nitropyridine-2-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-3-methoxy-5-nitropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118806375 |
| Molecular Formula | C8H6F2N2O5 |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 4-(difluoromethyl)-3-methoxy-5-nitropyridine-2-carboxylic acid |
| SMILES | COc1c(C(=O)O)ncc([N+](=O)[O-])c1C(F)F |
| InChI | InChI=1S/C8H6F2N2O5/c1-17-6-4(7(9)10)3(12(15)16)2-11-5(6)8(13)14/h2,7H,1H3,(H,13,14) |
| InChIKey | ARGRNVCMUALDKV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|