C8H8F3NO4S — CID 125434816
2-methoxy-6-(trifluoromethoxy)benzenesulfonamide (PubChem CID 125434816) has the molecular formula C8H8F3NO4S and a molecular weight of 271.22 g/mol. Its IUPAC name is 2-methoxy-6-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 2-methoxy-6-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 125434816 |
| Molecular Formula | C8H8F3NO4S |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 2-methoxy-6-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1cccc(OC(F)(F)F)c1S(N)(=O)=O |
| InChI | InChI=1S/C8H8F3NO4S/c1-15-5-3-2-4-6(16-8(9,10)11)7(5)17(12,13)14/h2-4H,1H3,(H2,12,13,14) |
| InChIKey | RSIXUWITPXWSKZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |