C9H12FNO3S2 — CID 23448653
2-(2-fluoroethylsulfanyl)-6-methoxybenzenesulfonamide (PubChem CID 23448653) has the molecular formula C9H12FNO3S2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-(2-fluoroethylsulfanyl)-6-methoxybenzenesulfonamide.
| Compound Name | 2-(2-fluoroethylsulfanyl)-6-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 23448653 |
| Molecular Formula | C9H12FNO3S2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-(2-fluoroethylsulfanyl)-6-methoxybenzenesulfonamide |
| SMILES | COc1cccc(SCCF)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H12FNO3S2/c1-14-7-3-2-4-8(15-6-5-10)9(7)16(11,12)13/h2-4H,5-6H2,1H3,(H2,11,12,13) |
| InChIKey | BGZOPWOCLRQVFK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |