C11H14N2O3S — CID 47449102
N-carbamoyl-3-(2-methoxyphenyl)sulfanylpropanamide (PubChem CID 47449102) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-carbamoyl-3-(2-methoxyphenyl)sulfanylpropanamide.
| Compound Name | N-carbamoyl-3-(2-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 47449102 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-carbamoyl-3-(2-methoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccccc1SCCC(=O)NC(N)=O |
| InChI | InChI=1S/C11H14N2O3S/c1-16-8-4-2-3-5-9(8)17-7-6-10(14)13-11(12)15/h2-5H,6-7H2,1H3,(H3,12,13,14,15) |
| InChIKey | RNBNYAXVXCAOSQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |