C12H15BrN2O3S — CID 122142252
4-(5-bromo-2-methoxyphenyl)sulfanyl-N-carbamoylbutanamide (PubChem CID 122142252) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is 4-(5-bromo-2-methoxyphenyl)sulfanyl-N-carbamoylbutanamide.
| Compound Name | 4-(5-bromo-2-methoxyphenyl)sulfanyl-N-carbamoylbutanamide |
|---|---|
| PubChem CID | 122142252 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 4-(5-bromo-2-methoxyphenyl)sulfanyl-N-carbamoylbutanamide |
| SMILES | COc1ccc(Br)cc1SCCCC(=O)NC(N)=O |
| InChI | InChI=1S/C12H15BrN2O3S/c1-18-9-5-4-8(13)7-10(9)19-6-2-3-11(16)15-12(14)17/h4-5,7H,2-3,6H2,1H3,(H3,14,15,16,17) |
| InChIKey | VQVHUDXYDXZAOD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|