C12H17N3O4 — CID 30114776
2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]-N-carbamoylacetamide (PubChem CID 30114776) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]-N-carbamoylacetamide.
| Compound Name | 2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 30114776 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]-N-carbamoylacetamide |
| SMILES | COc1cc([C@H](C)N)ccc1OCC(=O)NC(N)=O |
| InChI | InChI=1S/C12H17N3O4/c1-7(13)8-3-4-9(10(5-8)18-2)19-6-11(16)15-12(14)17/h3-5,7H,6,13H2,1-2H3,(H3,14,15,16,17)/t7-/m0/s1 |
| InChIKey | XKOFWQWTTXEJLU-ZETCQYMHSA-N |
| XLogP | 0.29 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |