C12H21ClO4S — CID 155744790
2,6-dimethoxybenzenesulfonyl chloride;ethane (PubChem CID 155744790) has the molecular formula C12H21ClO4S and a molecular weight of 296.82 g/mol. Its IUPAC name is 2,6-dimethoxybenzenesulfonyl chloride;ethane.
| Compound Name | 2,6-dimethoxybenzenesulfonyl chloride;ethane |
|---|---|
| PubChem CID | 155744790 |
| Molecular Formula | C12H21ClO4S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,6-dimethoxybenzenesulfonyl chloride;ethane |
| SMILES | CC.CC.COc1cccc(OC)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H9ClO4S.2C2H6/c1-12-6-4-3-5-7(13-2)8(6)14(9,10)11;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | FFSLQUZWWYLNOX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |