C7H7F2IN2O2S — CID 130086431
6-(difluoromethyl)-3-iodo-2-methylpyridine-4-sulfonamide (PubChem CID 130086431) has the molecular formula C7H7F2IN2O2S and a molecular weight of 348.11 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-iodo-2-methylpyridine-4-sulfonamide.
| Compound Name | 6-(difluoromethyl)-3-iodo-2-methylpyridine-4-sulfonamide |
|---|---|
| PubChem CID | 130086431 |
| Molecular Formula | C7H7F2IN2O2S |
| Molecular Weight | 348.11 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | 6-(difluoromethyl)-3-iodo-2-methylpyridine-4-sulfonamide |
| SMILES | Cc1nc(C(F)F)cc(S(N)(=O)=O)c1I |
| InChI | InChI=1S/C7H7F2IN2O2S/c1-3-6(10)5(15(11,13)14)2-4(12-3)7(8)9/h2,7H,1H3,(H2,11,13,14) |
| InChIKey | VAZCFHLJHQNOLS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|